C15H20F3NOS — CID 116614949
N-[[3,5-dimethyl-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]cyclopropanamine (PubChem CID 116614949) has the molecular formula C15H20F3NOS and a molecular weight of 319.39 g/mol. Its IUPAC name is N-[[3,5-dimethyl-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]cyclopropanamine.
| Compound Name | N-[[3,5-dimethyl-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 116614949 |
| Molecular Formula | C15H20F3NOS |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | N-[[3,5-dimethyl-4-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]cyclopropanamine |
| SMILES | Cc1cc(CNC2CC2)cc(C)c1OCCSC(F)(F)F |
| InChI | InChI=1S/C15H20F3NOS/c1-10-7-12(9-19-13-3-4-13)8-11(2)14(10)20-5-6-21-15(16,17)18/h7-8,13,19H,3-6,9H2,1-2H3 |
| InChIKey | IMHZZFWKMRDIOX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|