C11H20F3NS — CID 116615575
2,4-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine (PubChem CID 116615575) has the molecular formula C11H20F3NS and a molecular weight of 255.35 g/mol. Its IUPAC name is 2,4-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine.
| Compound Name | 2,4-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116615575 |
| Molecular Formula | C11H20F3NS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | 2,4-dimethyl-N-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCC(NCCSC(F)(F)F)C(C)C1 |
| InChI | InChI=1S/C11H20F3NS/c1-8-3-4-10(9(2)7-8)15-5-6-16-11(12,13)14/h8-10,15H,3-7H2,1-2H3 |
| InChIKey | HPGGAJFPBOPHJW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|