C10H18F3NS — CID 116616675
4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine (PubChem CID 116616675) has the molecular formula C10H18F3NS and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine.
| Compound Name | 4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 116616675 |
| Molecular Formula | C10H18F3NS |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 4-methyl-2-[2-(trifluoromethylsulfanyl)ethyl]cyclohexan-1-amine |
| SMILES | CC1CCC(N)C(CCSC(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NS/c1-7-2-3-9(14)8(6-7)4-5-15-10(11,12)13/h7-9H,2-6,14H2,1H3 |
| InChIKey | YUMHCIQNOLQLKU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |