C13H17F3N2O2S — CID 116616780
1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrrole-2-carboxylic acid (PubChem CID 116616780) has the molecular formula C13H17F3N2O2S and a molecular weight of 322.35 g/mol. Its IUPAC name is 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 116616780 |
| Molecular Formula | C13H17F3N2O2S |
| Molecular Weight | 322.35 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 1-[1-[2-(trifluoromethylsulfanyl)ethyl]piperidin-4-yl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1C1CCN(CCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H17F3N2O2S/c14-13(15,16)21-9-8-17-6-3-10(4-7-17)18-5-1-2-11(18)12(19)20/h1-2,5,10H,3-4,6-9H2,(H,19,20) |
| InChIKey | DNYLCWJEAAJNAF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |