C12H16F2N2O2 — CID 55103689
1-[1-(2,2-difluoroethyl)piperidin-4-yl]pyrrole-2-carboxylic acid (PubChem CID 55103689) has the molecular formula C12H16F2N2O2 and a molecular weight of 258.27 g/mol. Its IUPAC name is 1-[1-(2,2-difluoroethyl)piperidin-4-yl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 55103689 |
| Molecular Formula | C12H16F2N2O2 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 1-[1-(2,2-difluoroethyl)piperidin-4-yl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1C1CCN(CC(F)F)CC1 |
| InChI | InChI=1S/C12H16F2N2O2/c13-11(14)8-15-6-3-9(4-7-15)16-5-1-2-10(16)12(17)18/h1-2,5,9,11H,3-4,6-8H2,(H,17,18) |
| InChIKey | VZVKIWJWZXLIJA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |