C11H18F3N3OS — CID 116617521
1-piperidin-4-yl-3-[2-(trifluoromethylsulfanyl)ethyl]imidazolidin-2-one (PubChem CID 116617521) has the molecular formula C11H18F3N3OS and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-piperidin-4-yl-3-[2-(trifluoromethylsulfanyl)ethyl]imidazolidin-2-one.
| Compound Name | 1-piperidin-4-yl-3-[2-(trifluoromethylsulfanyl)ethyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 116617521 |
| Molecular Formula | C11H18F3N3OS |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-piperidin-4-yl-3-[2-(trifluoromethylsulfanyl)ethyl]imidazolidin-2-one |
| SMILES | O=C1N(CCSC(F)(F)F)CCN1C1CCNCC1 |
| InChI | InChI=1S/C11H18F3N3OS/c12-11(13,14)19-8-7-16-5-6-17(10(16)18)9-1-3-15-4-2-9/h9,15H,1-8H2 |
| InChIKey | GJIFRIUCBFXYCA-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |