C12H22FN3OS — CID 138607865
3-fluoro-N-[1-(1-sulfanylethyl)piperidin-4-yl]pyrrolidine-1-carboxamide (PubChem CID 138607865) has the molecular formula C12H22FN3OS and a molecular weight of 275.39 g/mol. Its IUPAC name is 3-fluoro-N-[1-(1-sulfanylethyl)piperidin-4-yl]pyrrolidine-1-carboxamide.
| Compound Name | 3-fluoro-N-[1-(1-sulfanylethyl)piperidin-4-yl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 138607865 |
| Molecular Formula | C12H22FN3OS |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 3-fluoro-N-[1-(1-sulfanylethyl)piperidin-4-yl]pyrrolidine-1-carboxamide |
| SMILES | CC(S)N1CCC(NC(=O)N2CCC(F)C2)CC1 |
| InChI | InChI=1S/C12H22FN3OS/c1-9(18)15-6-3-11(4-7-15)14-12(17)16-5-2-10(13)8-16/h9-11,18H,2-8H2,1H3,(H,14,17) |
| InChIKey | MMMXXJHBWGAARF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|