C11H20F3N3OS — CID 103912745
N,N-dimethyl-4-[2-(trifluoromethylsulfanyl)ethylamino]piperidine-1-carboxamide (PubChem CID 103912745) has the molecular formula C11H20F3N3OS and a molecular weight of 299.36 g/mol. Its IUPAC name is N,N-dimethyl-4-[2-(trifluoromethylsulfanyl)ethylamino]piperidine-1-carboxamide.
| Compound Name | N,N-dimethyl-4-[2-(trifluoromethylsulfanyl)ethylamino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 103912745 |
| Molecular Formula | C11H20F3N3OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N,N-dimethyl-4-[2-(trifluoromethylsulfanyl)ethylamino]piperidine-1-carboxamide |
| SMILES | CN(C)C(=O)N1CCC(NCCSC(F)(F)F)CC1 |
| InChI | InChI=1S/C11H20F3N3OS/c1-16(2)10(18)17-6-3-9(4-7-17)15-5-8-19-11(12,13)14/h9,15H,3-8H2,1-2H3 |
| InChIKey | QRJLXNNTJDBCHS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|