C16H22F3NS — CID 116617646
N-[2-[(3-methylphenyl)methyl]-4-(trifluoromethylsulfanyl)butyl]cyclopropanamine (PubChem CID 116617646) has the molecular formula C16H22F3NS and a molecular weight of 317.42 g/mol. Its IUPAC name is N-[2-[(3-methylphenyl)methyl]-4-(trifluoromethylsulfanyl)butyl]cyclopropanamine.
| Compound Name | N-[2-[(3-methylphenyl)methyl]-4-(trifluoromethylsulfanyl)butyl]cyclopropanamine |
|---|---|
| PubChem CID | 116617646 |
| Molecular Formula | C16H22F3NS |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | N-[2-[(3-methylphenyl)methyl]-4-(trifluoromethylsulfanyl)butyl]cyclopropanamine |
| SMILES | Cc1cccc(CC(CCSC(F)(F)F)CNC2CC2)c1 |
| InChI | InChI=1S/C16H22F3NS/c1-12-3-2-4-13(9-12)10-14(11-20-15-5-6-15)7-8-21-16(17,18)19/h2-4,9,14-15,20H,5-8,10-11H2,1H3 |
| InChIKey | PNOXERKSHGJJPA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |