C15H21BrF3NS — CID 116617660
2-[(3-bromophenyl)methyl]-N-propan-2-yl-4-(trifluoromethylsulfanyl)butan-1-amine (PubChem CID 116617660) has the molecular formula C15H21BrF3NS and a molecular weight of 384.31 g/mol. Its IUPAC name is 2-[(3-bromophenyl)methyl]-N-propan-2-yl-4-(trifluoromethylsulfanyl)butan-1-amine.
| Compound Name | 2-[(3-bromophenyl)methyl]-N-propan-2-yl-4-(trifluoromethylsulfanyl)butan-1-amine |
|---|---|
| PubChem CID | 116617660 |
| Molecular Formula | C15H21BrF3NS |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | 2-[(3-bromophenyl)methyl]-N-propan-2-yl-4-(trifluoromethylsulfanyl)butan-1-amine |
| SMILES | CC(C)NCC(CCSC(F)(F)F)Cc1cccc(Br)c1 |
| InChI | InChI=1S/C15H21BrF3NS/c1-11(2)20-10-13(6-7-21-15(17,18)19)8-12-4-3-5-14(16)9-12/h3-5,9,11,13,20H,6-8,10H2,1-2H3 |
| InChIKey | OPDWUBDQBGZQIR-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |