C14H24F3NS — CID 116617709
N-[[2-[2-(trifluoromethylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine (PubChem CID 116617709) has the molecular formula C14H24F3NS and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[[2-[2-(trifluoromethylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine.
| Compound Name | N-[[2-[2-(trifluoromethylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 116617709 |
| Molecular Formula | C14H24F3NS |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | N-[[2-[2-(trifluoromethylsulfanyl)ethyl]-2-bicyclo[2.2.1]heptanyl]methyl]propan-2-amine |
| SMILES | CC(C)NCC1(CCSC(F)(F)F)CC2CCC1C2 |
| InChI | InChI=1S/C14H24F3NS/c1-10(2)18-9-13(5-6-19-14(15,16)17)8-11-3-4-12(13)7-11/h10-12,18H,3-9H2,1-2H3 |
| InChIKey | LDKIAEXVZSYZJG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |