C11H18F3NS — CID 116617904
N-methyl-1-[3-[2-(trifluoromethylsulfanyl)ethyl]-3-bicyclo[3.1.0]hexanyl]methanamine (PubChem CID 116617904) has the molecular formula C11H18F3NS and a molecular weight of 253.33 g/mol. Its IUPAC name is N-methyl-1-[3-[2-(trifluoromethylsulfanyl)ethyl]-3-bicyclo[3.1.0]hexanyl]methanamine.
| Compound Name | N-methyl-1-[3-[2-(trifluoromethylsulfanyl)ethyl]-3-bicyclo[3.1.0]hexanyl]methanamine |
|---|---|
| PubChem CID | 116617904 |
| Molecular Formula | C11H18F3NS |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-methyl-1-[3-[2-(trifluoromethylsulfanyl)ethyl]-3-bicyclo[3.1.0]hexanyl]methanamine |
| SMILES | CNCC1(CCSC(F)(F)F)CC2CC2C1 |
| InChI | InChI=1S/C11H18F3NS/c1-15-7-10(2-3-16-11(12,13)14)5-8-4-9(8)6-10/h8-9,15H,2-7H2,1H3 |
| InChIKey | JRMLMAVINSHQLT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |