C12H13F2N — CID 116618758
1-(2,2-difluoroethyl)-7-ethylindole (PubChem CID 116618758) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-7-ethylindole.
| Compound Name | 1-(2,2-difluoroethyl)-7-ethylindole |
|---|---|
| PubChem CID | 116618758 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-7-ethylindole |
| SMILES | CCc1cccc2ccn(CC(F)F)c12 |
| InChI | InChI=1S/C12H13F2N/c1-2-9-4-3-5-10-6-7-15(12(9)10)8-11(13)14/h3-7,11H,2,8H2,1H3 |
| InChIKey | POHNJUDQVOBKJO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |