C21H25NOS — CID 70692727
1-(3,5-dimethylphenyl)sulfanyl-3-(7-ethylindol-1-yl)propan-2-ol (PubChem CID 70692727) has the molecular formula C21H25NOS and a molecular weight of 339.50 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)sulfanyl-3-(7-ethylindol-1-yl)propan-2-ol.
| Compound Name | 1-(3,5-dimethylphenyl)sulfanyl-3-(7-ethylindol-1-yl)propan-2-ol |
|---|---|
| PubChem CID | 70692727 |
| Molecular Formula | C21H25NOS |
| Molecular Weight | 339.50 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | 1-(3,5-dimethylphenyl)sulfanyl-3-(7-ethylindol-1-yl)propan-2-ol |
| SMILES | CCc1cccc2ccn(CC(O)CSc3cc(C)cc(C)c3)c12 |
| InChI | InChI=1S/C21H25NOS/c1-4-17-6-5-7-18-8-9-22(21(17)18)13-19(23)14-24-20-11-15(2)10-16(3)12-20/h5-12,19,23H,4,13-14H2,1-3H3 |
| InChIKey | QSHCQGQZUCCVDY-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.50 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |