C14H13BrN4O2 — CID 116619134
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-5-nitroindole (PubChem CID 116619134) has the molecular formula C14H13BrN4O2 and a molecular weight of 349.19 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-5-nitroindole.
| Compound Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-5-nitroindole |
|---|---|
| PubChem CID | 116619134 |
| Molecular Formula | C14H13BrN4O2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-5-nitroindole |
| SMILES | Cc1nn(C)c(Cn2ccc3cc([N+](=O)[O-])ccc32)c1Br |
| InChI | InChI=1S/C14H13BrN4O2/c1-9-14(15)13(17(2)16-9)8-18-6-5-10-7-11(19(20)21)3-4-12(10)18/h3-7H,8H2,1-2H3 |
| InChIKey | PKNNTYLXAPMDJX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 65.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|