C15H16BrN3 — CID 116620154
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-4-methylindole (PubChem CID 116620154) has the molecular formula C15H16BrN3 and a molecular weight of 318.22 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-4-methylindole.
| Compound Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-4-methylindole |
|---|---|
| PubChem CID | 116620154 |
| Molecular Formula | C15H16BrN3 |
| Molecular Weight | 318.22 g/mol |
| Exact Mass | 317.05 |
| IUPAC Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-4-methylindole |
| SMILES | Cc1nn(C)c(Cn2ccc3c(C)cccc32)c1Br |
| InChI | InChI=1S/C15H16BrN3/c1-10-5-4-6-13-12(10)7-8-19(13)9-14-15(16)11(2)17-18(14)3/h4-8H,9H2,1-3H3 |
| InChIKey | CDRKJFWMMAKOOJ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.22 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |