C14H21BrN4 — CID 66403138
N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine (PubChem CID 66403138) has the molecular formula C14H21BrN4 and a molecular weight of 325.25 g/mol. Its IUPAC name is N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66403138 |
| Molecular Formula | C14H21BrN4 |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | N-[[1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccn1Cc1c(Br)c(C)nn1C |
| InChI | InChI=1S/C14H21BrN4/c1-4-7-16-9-12-6-5-8-19(12)10-13-14(15)11(2)17-18(13)3/h5-6,8,16H,4,7,9-10H2,1-3H3 |
| InChIKey | APHYJZZNWRAJFQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|