C11H13BrN4S — CID 114654226
1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-2-carbothioamide (PubChem CID 114654226) has the molecular formula C11H13BrN4S and a molecular weight of 313.22 g/mol. Its IUPAC name is 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-2-carbothioamide.
| Compound Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-2-carbothioamide |
|---|---|
| PubChem CID | 114654226 |
| Molecular Formula | C11H13BrN4S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 1-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]pyrrole-2-carbothioamide |
| SMILES | Cc1nn(C)c(Cn2cccc2C(N)=S)c1Br |
| InChI | InChI=1S/C11H13BrN4S/c1-7-10(12)9(15(2)14-7)6-16-5-3-4-8(16)11(13)17/h3-5H,6H2,1-2H3,(H2,13,17) |
| InChIKey | FHJABTIRTHZOHU-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|