C15H23BrN4O — CID 66401466
N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine (PubChem CID 66401466) has the molecular formula C15H23BrN4O and a molecular weight of 355.28 g/mol. Its IUPAC name is N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine.
| Compound Name | N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 66401466 |
| Molecular Formula | C15H23BrN4O |
| Molecular Weight | 355.28 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[[1-[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methyl]pyrrol-2-yl]methyl]-2-methoxyethanamine |
| SMILES | CCn1nc(C)c(Br)c1Cn1cccc1CNCCOC |
| InChI | InChI=1S/C15H23BrN4O/c1-4-20-14(15(16)12(2)18-20)11-19-8-5-6-13(19)10-17-7-9-21-3/h5-6,8,17H,4,7,9-11H2,1-3H3 |
| InChIKey | NEMIQNGZHVTVPO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 44.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.28 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|