C14H23N5 — CID 66403720
N-[[1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine (PubChem CID 66403720) has the molecular formula C14H23N5 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-[[1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 66403720 |
| Molecular Formula | C14H23N5 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.20 |
| IUPAC Name | N-[[1-[(2-propan-2-yl-1,2,4-triazol-3-yl)methyl]pyrrol-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1cccn1Cc1ncnn1C(C)C |
| InChI | InChI=1S/C14H23N5/c1-4-7-15-9-13-6-5-8-18(13)10-14-16-11-17-19(14)12(2)3/h5-6,8,11-12,15H,4,7,9-10H2,1-3H3 |
| InChIKey | KLTLNFYZQUPINQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 47.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|