C13H18N2S — CID 116621649
1-(4-methylpentyl)-2-thiophen-2-ylimidazole (PubChem CID 116621649) has the molecular formula C13H18N2S and a molecular weight of 234.37 g/mol. Its IUPAC name is 1-(4-methylpentyl)-2-thiophen-2-ylimidazole.
| Compound Name | 1-(4-methylpentyl)-2-thiophen-2-ylimidazole |
|---|---|
| PubChem CID | 116621649 |
| Molecular Formula | C13H18N2S |
| Molecular Weight | 234.37 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1-(4-methylpentyl)-2-thiophen-2-ylimidazole |
| SMILES | CC(C)CCCn1ccnc1-c1cccs1 |
| InChI | InChI=1S/C13H18N2S/c1-11(2)5-3-8-15-9-7-14-13(15)12-6-4-10-16-12/h4,6-7,9-11H,3,5,8H2,1-2H3 |
| InChIKey | CFBJJLKOLSFEHY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.37 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |