C13H17N3OS — CID 116621663
N,N-dimethyl-4-(2-thiophen-2-ylimidazol-1-yl)butanamide (PubChem CID 116621663) has the molecular formula C13H17N3OS and a molecular weight of 263.37 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-thiophen-2-ylimidazol-1-yl)butanamide.
| Compound Name | N,N-dimethyl-4-(2-thiophen-2-ylimidazol-1-yl)butanamide |
|---|---|
| PubChem CID | 116621663 |
| Molecular Formula | C13H17N3OS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.11 |
| IUPAC Name | N,N-dimethyl-4-(2-thiophen-2-ylimidazol-1-yl)butanamide |
| SMILES | CN(C)C(=O)CCCn1ccnc1-c1cccs1 |
| InChI | InChI=1S/C13H17N3OS/c1-15(2)12(17)6-3-8-16-9-7-14-13(16)11-5-4-10-18-11/h4-5,7,9-10H,3,6,8H2,1-2H3 |
| InChIKey | MMZHDSRRUBMIPU-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |