C17H16BrN — CID 116621819
6-bromo-1-[(2,5-dimethylphenyl)methyl]indole (PubChem CID 116621819) has the molecular formula C17H16BrN and a molecular weight of 314.23 g/mol. Its IUPAC name is 6-bromo-1-[(2,5-dimethylphenyl)methyl]indole.
| Compound Name | 6-bromo-1-[(2,5-dimethylphenyl)methyl]indole |
|---|---|
| PubChem CID | 116621819 |
| Molecular Formula | C17H16BrN |
| Molecular Weight | 314.23 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 6-bromo-1-[(2,5-dimethylphenyl)methyl]indole |
| SMILES | Cc1ccc(C)c(Cn2ccc3ccc(Br)cc32)c1 |
| InChI | InChI=1S/C17H16BrN/c1-12-3-4-13(2)15(9-12)11-19-8-7-14-5-6-16(18)10-17(14)19/h3-10H,11H2,1-2H3 |
| InChIKey | IBWKOPAXSFSANF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.23 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |