C11H16F3NS — CID 116627804
3-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclopentane-1-carbonitrile (PubChem CID 116627804) has the molecular formula C11H16F3NS and a molecular weight of 251.32 g/mol. Its IUPAC name is 3-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclopentane-1-carbonitrile.
| Compound Name | 3-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclopentane-1-carbonitrile |
|---|---|
| PubChem CID | 116627804 |
| Molecular Formula | C11H16F3NS |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | 3-ethyl-1-[2-(trifluoromethylsulfanyl)ethyl]cyclopentane-1-carbonitrile |
| SMILES | CCC1CCC(C#N)(CCSC(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3NS/c1-2-9-3-4-10(7-9,8-15)5-6-16-11(12,13)14/h9H,2-7H2,1H3 |
| InChIKey | GNAVNPWEZWDBPK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |