C13H21F2NS — CID 138488621
(3aS,6aR)-5,5-difluoro-2-[(trimethyl-λ4-sulfanyl)methyl]-1,3,3a,4,6,6a-hexahydropentalene-2-carbonitrile (PubChem CID 138488621) has the molecular formula C13H21F2NS and a molecular weight of 261.38 g/mol. Its IUPAC name is (3aS,6aR)-5,5-difluoro-2-[(trimethyl-λ4-sulfanyl)methyl]-1,3,3a,4,6,6a-hexahydropentalene-2-carbonitrile.
| Compound Name | (3aS,6aR)-5,5-difluoro-2-[(trimethyl-λ4-sulfanyl)methyl]-1,3,3a,4,6,6a-hexahydropentalene-2-carbonitrile |
|---|---|
| PubChem CID | 138488621 |
| Molecular Formula | C13H21F2NS |
| Molecular Weight | 261.38 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (3aS,6aR)-5,5-difluoro-2-[(trimethyl-λ4-sulfanyl)methyl]-1,3,3a,4,6,6a-hexahydropentalene-2-carbonitrile |
| SMILES | CS(C)(C)CC1(C#N)C[C@H]2CC(F)(F)C[C@H]2C1 |
| InChI | InChI=1S/C13H21F2NS/c1-17(2,3)9-12(8-16)4-10-6-13(14,15)7-11(10)5-12/h10-11H,4-7,9H2,1-3H3/t10-,11+,12? |
| InChIKey | WKLAAERVSKRHAQ-FOSCPWQOSA-N |
| XLogP | 3.65 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |