C8H11F3O4S — CID 116628325
2-ethoxycarbonyl-4-(trifluoromethylsulfanyl)butanoic acid (PubChem CID 116628325) has the molecular formula C8H11F3O4S and a molecular weight of 260.23 g/mol. Its IUPAC name is 2-ethoxycarbonyl-4-(trifluoromethylsulfanyl)butanoic acid.
| Compound Name | 2-ethoxycarbonyl-4-(trifluoromethylsulfanyl)butanoic acid |
|---|---|
| PubChem CID | 116628325 |
| Molecular Formula | C8H11F3O4S |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.03 |
| IUPAC Name | 2-ethoxycarbonyl-4-(trifluoromethylsulfanyl)butanoic acid |
| SMILES | CCOC(=O)C(CCSC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C8H11F3O4S/c1-2-15-7(14)5(6(12)13)3-4-16-8(9,10)11/h5H,2-4H2,1H3,(H,12,13) |
| InChIKey | ATCKMYFOEXAHKG-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|