C13H17F3N2O3 — CID 116628870
3-amino-N-(1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide (PubChem CID 116628870) has the molecular formula C13H17F3N2O3 and a molecular weight of 306.28 g/mol. Its IUPAC name is 3-amino-N-(1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide.
| Compound Name | 3-amino-N-(1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 116628870 |
| Molecular Formula | C13H17F3N2O3 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 3-amino-N-(1-methoxybutan-2-yl)-4-(trifluoromethoxy)benzamide |
| SMILES | CCC(COC)NC(=O)c1ccc(OC(F)(F)F)c(N)c1 |
| InChI | InChI=1S/C13H17F3N2O3/c1-3-9(7-20-2)18-12(19)8-4-5-11(10(17)6-8)21-13(14,15)16/h4-6,9H,3,7,17H2,1-2H3,(H,18,19) |
| InChIKey | GAURSOJZSUEBRG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|