C14H16ClN3O3 — CID 116630567
5-[(4-chloro-2-methoxy-5-methylanilino)methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116630567) has the molecular formula C14H16ClN3O3 and a molecular weight of 309.75 g/mol. Its IUPAC name is 5-[(4-chloro-2-methoxy-5-methylanilino)methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-chloro-2-methoxy-5-methylanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116630567 |
| Molecular Formula | C14H16ClN3O3 |
| Molecular Weight | 309.75 g/mol |
| Exact Mass | 309.09 |
| IUPAC Name | 5-[(4-chloro-2-methoxy-5-methylanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | COc1cc(Cl)c(C)cc1NCc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C14H16ClN3O3/c1-8-4-11(13(21-3)5-10(8)15)16-7-12-9(14(19)20)6-17-18(12)2/h4-6,16H,7H2,1-3H3,(H,19,20) |
| InChIKey | INHZQKLTVGFZOG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |