C14H14N4O3 — CID 116631557
5-[(4-cyano-2-methoxyanilino)methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116631557) has the molecular formula C14H14N4O3 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-[(4-cyano-2-methoxyanilino)methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-cyano-2-methoxyanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116631557 |
| Molecular Formula | C14H14N4O3 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 5-[(4-cyano-2-methoxyanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | COc1cc(C#N)ccc1NCc1c(C(=O)O)cnn1C |
| InChI | InChI=1S/C14H14N4O3/c1-18-12(10(7-17-18)14(19)20)8-16-11-4-3-9(6-15)5-13(11)21-2/h3-5,7,16H,8H2,1-2H3,(H,19,20) |
| InChIKey | HHMWCSQEDARLMS-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 100.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |