C12H11ClIN3O2 — CID 107635370
5-[(4-chloro-2-iodoanilino)methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 107635370) has the molecular formula C12H11ClIN3O2 and a molecular weight of 391.60 g/mol. Its IUPAC name is 5-[(4-chloro-2-iodoanilino)methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(4-chloro-2-iodoanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 107635370 |
| Molecular Formula | C12H11ClIN3O2 |
| Molecular Weight | 391.60 g/mol |
| Exact Mass | 390.96 |
| IUPAC Name | 5-[(4-chloro-2-iodoanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1CNc1ccc(Cl)cc1I |
| InChI | InChI=1S/C12H11ClIN3O2/c1-17-11(8(5-16-17)12(18)19)6-15-10-3-2-7(13)4-9(10)14/h2-5,15H,6H2,1H3,(H,18,19) |
| InChIKey | ODFCAGRWDRYUTG-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.60 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|