C13H12N4O2 — CID 116630638
5-[(3-cyanoanilino)methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116630638) has the molecular formula C13H12N4O2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 5-[(3-cyanoanilino)methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[(3-cyanoanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116630638 |
| Molecular Formula | C13H12N4O2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 5-[(3-cyanoanilino)methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1CNc1cccc(C#N)c1 |
| InChI | InChI=1S/C13H12N4O2/c1-17-12(11(7-16-17)13(18)19)8-15-10-4-2-3-9(5-10)6-14/h2-5,7,15H,8H2,1H3,(H,18,19) |
| InChIKey | WFPQOFNIRRVONY-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |