C12H14ClN3O2S — CID 116630950
5-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-1-methylpyrazole-4-carboxylic acid (PubChem CID 116630950) has the molecular formula C12H14ClN3O2S and a molecular weight of 299.78 g/mol. Its IUPAC name is 5-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 116630950 |
| Molecular Formula | C12H14ClN3O2S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | 5-[[1-(5-chlorothiophen-2-yl)ethylamino]methyl]-1-methylpyrazole-4-carboxylic acid |
| SMILES | CC(NCc1c(C(=O)O)cnn1C)c1ccc(Cl)s1 |
| InChI | InChI=1S/C12H14ClN3O2S/c1-7(10-3-4-11(13)19-10)14-6-9-8(12(17)18)5-15-16(9)2/h3-5,7,14H,6H2,1-2H3,(H,17,18) |
| InChIKey | MMWAMHYFRVXXLB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |