C15H26N4O — CID 116635501
[1-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]azepan-2-yl]methanol (PubChem CID 116635501) has the molecular formula C15H26N4O and a molecular weight of 278.40 g/mol. Its IUPAC name is [1-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]azepan-2-yl]methanol.
| Compound Name | [1-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116635501 |
| Molecular Formula | C15H26N4O |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.21 |
| IUPAC Name | [1-[5-[(propan-2-ylamino)methyl]pyrimidin-2-yl]azepan-2-yl]methanol |
| SMILES | CC(C)NCc1cnc(N2CCCCCC2CO)nc1 |
| InChI | InChI=1S/C15H26N4O/c1-12(2)16-8-13-9-17-15(18-10-13)19-7-5-3-4-6-14(19)11-20/h9-10,12,14,16,20H,3-8,11H2,1-2H3 |
| InChIKey | CKNHSPDKQLQEGQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |