C15H22F2N2O — CID 63076607
[1-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenyl]pyrrolidin-2-yl]methanol (PubChem CID 63076607) has the molecular formula C15H22F2N2O and a molecular weight of 284.35 g/mol. Its IUPAC name is [1-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenyl]pyrrolidin-2-yl]methanol.
| Compound Name | [1-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenyl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 63076607 |
| Molecular Formula | C15H22F2N2O |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.17 |
| IUPAC Name | [1-[2,6-difluoro-4-[(propan-2-ylamino)methyl]phenyl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)NCc1cc(F)c(N2CCCC2CO)c(F)c1 |
| InChI | InChI=1S/C15H22F2N2O/c1-10(2)18-8-11-6-13(16)15(14(17)7-11)19-5-3-4-12(19)9-20/h6-7,10,12,18,20H,3-5,8-9H2,1-2H3 |
| InChIKey | FUWABHFSEDBAFW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|