C14H18N2O3S — CID 116637004
[1-(1,1-dioxo-1,2-benzothiazol-3-yl)azepan-2-yl]methanol (PubChem CID 116637004) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is [1-(1,1-dioxo-1,2-benzothiazol-3-yl)azepan-2-yl]methanol.
| Compound Name | [1-(1,1-dioxo-1,2-benzothiazol-3-yl)azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116637004 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | [1-(1,1-dioxo-1,2-benzothiazol-3-yl)azepan-2-yl]methanol |
| SMILES | O=S1(=O)N=C(N2CCCCCC2CO)c2ccccc21 |
| InChI | InChI=1S/C14H18N2O3S/c17-10-11-6-2-1-5-9-16(11)14-12-7-3-4-8-13(12)20(18,19)15-14/h3-4,7-8,11,17H,1-2,5-6,9-10H2 |
| InChIKey | ZOGGKOGIGPUIGK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |