C14H22N2O2 — CID 116637566
1-[2-[2-(hydroxymethyl)azepan-1-yl]ethyl]pyridin-2-one (PubChem CID 116637566) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[2-[2-(hydroxymethyl)azepan-1-yl]ethyl]pyridin-2-one.
| Compound Name | 1-[2-[2-(hydroxymethyl)azepan-1-yl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 116637566 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-[2-[2-(hydroxymethyl)azepan-1-yl]ethyl]pyridin-2-one |
| SMILES | O=c1ccccn1CCN1CCCCCC1CO |
| InChI | InChI=1S/C14H22N2O2/c17-12-13-6-2-1-4-8-15(13)10-11-16-9-5-3-7-14(16)18/h3,5,7,9,13,17H,1-2,4,6,8,10-12H2 |
| InChIKey | CMEFPETZUDFDJA-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |