C33H45NO5 — CID 11663794
(4R)-4-benzyl-3-[2-[(3R,4S)-3-phenylmethoxytetradec-1-en-4-yl]oxyacetyl]-1,3-oxazolidin-2-one (PubChem CID 11663794) has the molecular formula C33H45NO5 and a molecular weight of 535.73 g/mol. Its IUPAC name is (4R)-4-benzyl-3-[2-[(3R,4S)-3-phenylmethoxytetradec-1-en-4-yl]oxyacetyl]-1,3-oxazolidin-2-one.
| Compound Name | (4R)-4-benzyl-3-[2-[(3R,4S)-3-phenylmethoxytetradec-1-en-4-yl]oxyacetyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 11663794 |
| Molecular Formula | C33H45NO5 |
| Molecular Weight | 535.73 g/mol |
| Exact Mass | 535.33 |
| IUPAC Name | (4R)-4-benzyl-3-[2-[(3R,4S)-3-phenylmethoxytetradec-1-en-4-yl]oxyacetyl]-1,3-oxazolidin-2-one |
| SMILES | C=C[C@@H](OCc1ccccc1)[C@H](CCCCCCCCCC)OCC(=O)N1C(=O)OC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C33H45NO5/c1-3-5-6-7-8-9-10-17-22-31(30(4-2)37-24-28-20-15-12-16-21-28)38-26-32(35)34-29(25-39-33(34)36)23-27-18-13-11-14-19-27/h4,11-16,18-21,29-31H,2-3,5-10,17,22-26H2,1H3/t29-,30-,31+/m1/s1 |
| InChIKey | SLZBQHSQITYRDS-OLUZHXLYSA-N |
| XLogP | 7.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.73 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|