C18H30N2O — CID 116638200
[1-(3-amino-2,2-dimethyl-3-phenylpropyl)azepan-2-yl]methanol (PubChem CID 116638200) has the molecular formula C18H30N2O and a molecular weight of 290.45 g/mol. Its IUPAC name is [1-(3-amino-2,2-dimethyl-3-phenylpropyl)azepan-2-yl]methanol.
| Compound Name | [1-(3-amino-2,2-dimethyl-3-phenylpropyl)azepan-2-yl]methanol |
|---|---|
| PubChem CID | 116638200 |
| Molecular Formula | C18H30N2O |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.24 |
| IUPAC Name | [1-(3-amino-2,2-dimethyl-3-phenylpropyl)azepan-2-yl]methanol |
| SMILES | CC(C)(CN1CCCCCC1CO)C(N)c1ccccc1 |
| InChI | InChI=1S/C18H30N2O/c1-18(2,17(19)15-9-5-3-6-10-15)14-20-12-8-4-7-11-16(20)13-21/h3,5-6,9-10,16-17,21H,4,7-8,11-14,19H2,1-2H3 |
| InChIKey | XULIGTPTBRFLKX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |