About 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol
1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol (PubChem CID 106674147) has the molecular formula C15H24N2O2
and a molecular weight of 264.37 g/mol. Its IUPAC name is 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol.
Molecular Properties
| Compound Name | 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol |
| PubChem CID | 106674147 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol |
| SMILES | CC(C)(CN1CC(O)C(O)C1)C(N)c1ccccc1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2,10-17-8-12(18)13(19)9-17)14(16)11-6-4-3-5-7-11/h3-7,12-14,18-19H,8-10,16H2,1-2H3 |
| InChIKey | LJYOAANYSBBFEZ-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol?
The IUPAC name of 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol (CID 106674147) is 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol.
What is the SMILES notation for 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol?
The canonical SMILES for 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol is CC(C)(CN1CC(O)C(O)C1)C(N)c1ccccc1.
What is the InChIKey of 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol?
The InChIKey is LJYOAANYSBBFEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O2/c1-15(2,10-17-8-12(18)13(19)9-17)14(16)11-6-4-3-5-7-11/h3-7,12-14,18-19H,8-10,16H2,1-2H3.
What are the key properties of 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol?
1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol has a molecular weight of 264.37 g/mol, XLogP of 0.75, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-2,2-dimethyl-3-phenylpropyl)pyrrolidine-3,4-diol is sourced from PubChem (CID 106674147), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).