C17H19BrN2O — CID 116639380
[2-(bromomethyl)azepan-1-yl]-isoquinolin-1-ylmethanone (PubChem CID 116639380) has the molecular formula C17H19BrN2O and a molecular weight of 347.26 g/mol. Its IUPAC name is [2-(bromomethyl)azepan-1-yl]-isoquinolin-1-ylmethanone.
| Compound Name | [2-(bromomethyl)azepan-1-yl]-isoquinolin-1-ylmethanone |
|---|---|
| PubChem CID | 116639380 |
| Molecular Formula | C17H19BrN2O |
| Molecular Weight | 347.26 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | [2-(bromomethyl)azepan-1-yl]-isoquinolin-1-ylmethanone |
| SMILES | O=C(c1nccc2ccccc12)N1CCCCCC1CBr |
| InChI | InChI=1S/C17H19BrN2O/c18-12-14-7-2-1-5-11-20(14)17(21)16-15-8-4-3-6-13(15)9-10-19-16/h3-4,6,8-10,14H,1-2,5,7,11-12H2 |
| InChIKey | IRUKKMDGNFLHTR-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.26 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|