C14H16BrCl2NO — CID 116639616
[2-(bromomethyl)azepan-1-yl]-(3,5-dichlorophenyl)methanone (PubChem CID 116639616) has the molecular formula C14H16BrCl2NO and a molecular weight of 365.10 g/mol. Its IUPAC name is [2-(bromomethyl)azepan-1-yl]-(3,5-dichlorophenyl)methanone.
| Compound Name | [2-(bromomethyl)azepan-1-yl]-(3,5-dichlorophenyl)methanone |
|---|---|
| PubChem CID | 116639616 |
| Molecular Formula | C14H16BrCl2NO |
| Molecular Weight | 365.10 g/mol |
| Exact Mass | 362.98 |
| IUPAC Name | [2-(bromomethyl)azepan-1-yl]-(3,5-dichlorophenyl)methanone |
| SMILES | O=C(c1cc(Cl)cc(Cl)c1)N1CCCCCC1CBr |
| InChI | InChI=1S/C14H16BrCl2NO/c15-9-13-4-2-1-3-5-18(13)14(19)10-6-11(16)8-12(17)7-10/h6-8,13H,1-5,9H2 |
| InChIKey | XSYCBXYTBHPIIE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.10 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|