C14H17BrClNO — CID 80659471
[2-(bromomethyl)piperidin-1-yl]-(3-chloro-4-methylphenyl)methanone (PubChem CID 80659471) has the molecular formula C14H17BrClNO and a molecular weight of 330.65 g/mol. Its IUPAC name is [2-(bromomethyl)piperidin-1-yl]-(3-chloro-4-methylphenyl)methanone.
| Compound Name | [2-(bromomethyl)piperidin-1-yl]-(3-chloro-4-methylphenyl)methanone |
|---|---|
| PubChem CID | 80659471 |
| Molecular Formula | C14H17BrClNO |
| Molecular Weight | 330.65 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | [2-(bromomethyl)piperidin-1-yl]-(3-chloro-4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCCCC2CBr)cc1Cl |
| InChI | InChI=1S/C14H17BrClNO/c1-10-5-6-11(8-13(10)16)14(18)17-7-3-2-4-12(17)9-15/h5-6,8,12H,2-4,7,9H2,1H3 |
| InChIKey | PFZSIOJEEPQLSP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.65 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|