C15H22BrNOS — CID 116639623
1-[2-(bromomethyl)azepan-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 116639623) has the molecular formula C15H22BrNOS and a molecular weight of 344.32 g/mol. Its IUPAC name is 1-[2-(bromomethyl)azepan-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[2-(bromomethyl)azepan-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 116639623 |
| Molecular Formula | C15H22BrNOS |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-[2-(bromomethyl)azepan-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | O=C(CCCc1cccs1)N1CCCCCC1CBr |
| InChI | InChI=1S/C15H22BrNOS/c16-12-13-6-2-1-3-10-17(13)15(18)9-4-7-14-8-5-11-19-14/h5,8,11,13H,1-4,6-7,9-10,12H2 |
| InChIKey | KYEVNQVSTBGZES-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|