C18H25N3OS — CID 95603055
1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one (PubChem CID 95603055) has the molecular formula C18H25N3OS and a molecular weight of 331.48 g/mol. Its IUPAC name is 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one.
| Compound Name | 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 95603055 |
| Molecular Formula | C18H25N3OS |
| Molecular Weight | 331.48 g/mol |
| Exact Mass | 331.17 |
| IUPAC Name | 1-[(2R)-2-[(4-methylpyrazol-1-yl)methyl]piperidin-1-yl]-4-thiophen-2-ylbutan-1-one |
| SMILES | Cc1cnn(C[C@H]2CCCCN2C(=O)CCCc2cccs2)c1 |
| InChI | InChI=1S/C18H25N3OS/c1-15-12-19-20(13-15)14-16-6-2-3-10-21(16)18(22)9-4-7-17-8-5-11-23-17/h5,8,11-13,16H,2-4,6-7,9-10,14H2,1H3/t16-/m1/s1 |
| InChIKey | MNIGEXSBFPIQAA-MRXNPFEDSA-N |
| XLogP | 3.66 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.48 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |