C17H26N2O — CID 116640577
[1-(3,4-dihydro-2H-chromen-4-ylmethyl)azepan-2-yl]methanamine (PubChem CID 116640577) has the molecular formula C17H26N2O and a molecular weight of 274.41 g/mol. Its IUPAC name is [1-(3,4-dihydro-2H-chromen-4-ylmethyl)azepan-2-yl]methanamine.
| Compound Name | [1-(3,4-dihydro-2H-chromen-4-ylmethyl)azepan-2-yl]methanamine |
|---|---|
| PubChem CID | 116640577 |
| Molecular Formula | C17H26N2O |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | [1-(3,4-dihydro-2H-chromen-4-ylmethyl)azepan-2-yl]methanamine |
| SMILES | NCC1CCCCCN1CC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H26N2O/c18-12-15-6-2-1-5-10-19(15)13-14-9-11-20-17-8-4-3-7-16(14)17/h3-4,7-8,14-15H,1-2,5-6,9-13,18H2 |
| InChIKey | WYZNCQRYESBMHW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |