C12H9Cl2N3O2 — CID 116640812
4-amino-2-[(2,4-dichlorophenyl)methyl]pyrimidine-5-carboxylic acid (PubChem CID 116640812) has the molecular formula C12H9Cl2N3O2 and a molecular weight of 298.13 g/mol. Its IUPAC name is 4-amino-2-[(2,4-dichlorophenyl)methyl]pyrimidine-5-carboxylic acid.
| Compound Name | 4-amino-2-[(2,4-dichlorophenyl)methyl]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 116640812 |
| Molecular Formula | C12H9Cl2N3O2 |
| Molecular Weight | 298.13 g/mol |
| Exact Mass | 297.01 |
| IUPAC Name | 4-amino-2-[(2,4-dichlorophenyl)methyl]pyrimidine-5-carboxylic acid |
| SMILES | Nc1nc(Cc2ccc(Cl)cc2Cl)ncc1C(=O)O |
| InChI | InChI=1S/C12H9Cl2N3O2/c13-7-2-1-6(9(14)4-7)3-10-16-5-8(12(18)19)11(15)17-10/h1-2,4-5H,3H2,(H,18,19)(H2,15,16,17) |
| InChIKey | MLDRMONTWYNPFK-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.13 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |