C13H7BrCl3NO2 — CID 59636559
4-[(4-bromo-2-chlorophenyl)methyl]-5,6-dichloropyridine-3-carboxylic acid (PubChem CID 59636559) has the molecular formula C13H7BrCl3NO2 and a molecular weight of 395.47 g/mol. Its IUPAC name is 4-[(4-bromo-2-chlorophenyl)methyl]-5,6-dichloropyridine-3-carboxylic acid.
| Compound Name | 4-[(4-bromo-2-chlorophenyl)methyl]-5,6-dichloropyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 59636559 |
| Molecular Formula | C13H7BrCl3NO2 |
| Molecular Weight | 395.47 g/mol |
| Exact Mass | 392.87 |
| IUPAC Name | 4-[(4-bromo-2-chlorophenyl)methyl]-5,6-dichloropyridine-3-carboxylic acid |
| SMILES | O=C(O)c1cnc(Cl)c(Cl)c1Cc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C13H7BrCl3NO2/c14-7-2-1-6(10(15)4-7)3-8-9(13(19)20)5-18-12(17)11(8)16/h1-2,4-5H,3H2,(H,19,20) |
| InChIKey | AWCRPVJYKUBYKV-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.47 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|