C12H22N4 — CID 116642225
2-[1-(3,4-dimethylcyclohexyl)triazol-4-yl]ethanamine (PubChem CID 116642225) has the molecular formula C12H22N4 and a molecular weight of 222.34 g/mol. Its IUPAC name is 2-[1-(3,4-dimethylcyclohexyl)triazol-4-yl]ethanamine.
| Compound Name | 2-[1-(3,4-dimethylcyclohexyl)triazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 116642225 |
| Molecular Formula | C12H22N4 |
| Molecular Weight | 222.34 g/mol |
| Exact Mass | 222.18 |
| IUPAC Name | 2-[1-(3,4-dimethylcyclohexyl)triazol-4-yl]ethanamine |
| SMILES | CC1CCC(n2cc(CCN)nn2)CC1C |
| InChI | InChI=1S/C12H22N4/c1-9-3-4-12(7-10(9)2)16-8-11(5-6-13)14-15-16/h8-10,12H,3-7,13H2,1-2H3 |
| InChIKey | FFYQMCRBBTYPFS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |