About [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol
[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol (PubChem CID 165444649) has the molecular formula C8H14N4O
and a molecular weight of 182.23 g/mol. Its IUPAC name is [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol.
Molecular Properties
| Compound Name | [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol |
| PubChem CID | 165444649 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol |
| SMILES | N[C@@H]1CC[C@H](n2cc(CO)nn2)C1 |
| InChI | InChI=1S/C8H14N4O/c9-6-1-2-8(3-6)12-4-7(5-13)10-11-12/h4,6,8,13H,1-3,5,9H2/t6-,8+/m1/s1 |
| InChIKey | AOSSGFSWYMGZHP-SVRRBLITSA-N |
| XLogP | -0.18 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol?
The IUPAC name of [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol (CID 165444649) is [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol.
What is the SMILES notation for [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol?
The canonical SMILES for [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol is N[C@@H]1CC[C@H](n2cc(CO)nn2)C1.
What is the InChIKey of [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol?
The InChIKey is AOSSGFSWYMGZHP-SVRRBLITSA-N. The full InChI is InChI=1S/C8H14N4O/c9-6-1-2-8(3-6)12-4-7(5-13)10-11-12/h4,6,8,13H,1-3,5,9H2/t6-,8+/m1/s1.
What are the key properties of [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol?
[1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol has a molecular weight of 182.23 g/mol, XLogP of -0.18, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(1S,3R)-3-aminocyclopentyl]triazol-4-yl]methanol is sourced from PubChem (CID 165444649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).