C14H17N5 — CID 116642927
N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]pent-3-yn-1-amine (PubChem CID 116642927) has the molecular formula C14H17N5 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]pent-3-yn-1-amine.
| Compound Name | N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]pent-3-yn-1-amine |
|---|---|
| PubChem CID | 116642927 |
| Molecular Formula | C14H17N5 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.15 |
| IUPAC Name | N-[1-[3-(tetrazol-1-yl)phenyl]ethyl]pent-3-yn-1-amine |
| SMILES | CC#CCCNC(C)c1cccc(-n2cnnn2)c1 |
| InChI | InChI=1S/C14H17N5/c1-3-4-5-9-15-12(2)13-7-6-8-14(10-13)19-11-16-17-18-19/h6-8,10-12,15H,5,9H2,1-2H3 |
| InChIKey | TVLFJLKSYKXLNF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|